C19H21N7 — CID 126810476
9-ethyl-6-[2-(6-methyl-1H-benzimidazol-2-yl)pyrrolidin-1-yl]purine (PubChem CID 126810476) has the molecular formula C19H21N7 and a molecular weight of 347.43 g/mol. Its IUPAC name is 9-ethyl-6-[2-(6-methyl-1H-benzimidazol-2-yl)pyrrolidin-1-yl]purine.
| Compound Name | 9-ethyl-6-[2-(6-methyl-1H-benzimidazol-2-yl)pyrrolidin-1-yl]purine |
|---|---|
| PubChem CID | 126810476 |
| Molecular Formula | C19H21N7 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 9-ethyl-6-[2-(6-methyl-1H-benzimidazol-2-yl)pyrrolidin-1-yl]purine |
| SMILES | CCn1cnc2c(N3CCCC3c3nc4ccc(C)cc4[nH]3)ncnc21 |
| InChI | InChI=1S/C19H21N7/c1-3-25-11-22-16-18(25)20-10-21-19(16)26-8-4-5-15(26)17-23-13-7-6-12(2)9-14(13)24-17/h6-7,9-11,15H,3-5,8H2,1-2H3,(H,23,24) |
| InChIKey | QYIUFNMDDJSUOK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |