C9H13N3O2 — CID 126810764
N-(2-aminoethyl)-1-methyl-6-oxopyridine-3-carboxamide (PubChem CID 126810764) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-methyl-6-oxopyridine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-methyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 126810764 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N-(2-aminoethyl)-1-methyl-6-oxopyridine-3-carboxamide |
| SMILES | Cn1cc(C(=O)NCCN)ccc1=O |
| InChI | InChI=1S/C9H13N3O2/c1-12-6-7(2-3-8(12)13)9(14)11-5-4-10/h2-3,6H,4-5,10H2,1H3,(H,11,14) |
| InChIKey | MBASUXNNJWJUFS-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |