C16H25N3O — CID 126810852
[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-ethyl-2,5-dimethylpyrrol-3-yl)methanone (PubChem CID 126810852) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is [(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-ethyl-2,5-dimethylpyrrol-3-yl)methanone.
| Compound Name | [(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-ethyl-2,5-dimethylpyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 126810852 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | [(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-ethyl-2,5-dimethylpyrrol-3-yl)methanone |
| SMILES | CCn1c(C)cc(C(=O)N2C[C@H]3CN(C)C[C@H]3C2)c1C |
| InChI | InChI=1S/C16H25N3O/c1-5-19-11(2)6-15(12(19)3)16(20)18-9-13-7-17(4)8-14(13)10-18/h6,13-14H,5,7-10H2,1-4H3/t13-,14+ |
| InChIKey | BUBBYELYQWYYNO-OKILXGFUSA-N |
| XLogP | 1.76 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |