C16H22N2O5S — CID 126811914
2,6-dimethyl-3-(3-oxo-4-propan-2-ylpiperazin-1-yl)sulfonylbenzoic acid (PubChem CID 126811914) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is 2,6-dimethyl-3-(3-oxo-4-propan-2-ylpiperazin-1-yl)sulfonylbenzoic acid.
| Compound Name | 2,6-dimethyl-3-(3-oxo-4-propan-2-ylpiperazin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 126811914 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2,6-dimethyl-3-(3-oxo-4-propan-2-ylpiperazin-1-yl)sulfonylbenzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(C)C)C(=O)C2)c(C)c1C(=O)O |
| InChI | InChI=1S/C16H22N2O5S/c1-10(2)18-8-7-17(9-14(18)19)24(22,23)13-6-5-11(3)15(12(13)4)16(20)21/h5-6,10H,7-9H2,1-4H3,(H,20,21) |
| InChIKey | UHJGRLIKEWDXHX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |