C21H19NO4S — CID 20505965
2,6-dimethyl-3-[(4-phenylphenyl)sulfamoyl]benzoic acid (PubChem CID 20505965) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2,6-dimethyl-3-[(4-phenylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 2,6-dimethyl-3-[(4-phenylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 20505965 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2,6-dimethyl-3-[(4-phenylphenyl)sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(-c3ccccc3)cc2)c(C)c1C(=O)O |
| InChI | InChI=1S/C21H19NO4S/c1-14-8-13-19(15(2)20(14)21(23)24)27(25,26)22-18-11-9-17(10-12-18)16-6-4-3-5-7-16/h3-13,22H,1-2H3,(H,23,24) |
| InChIKey | YFESNLNGOILSFI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |