C21H30N2O2 — CID 126813294
2,7-diazaspiro[4.5]decan-7-yl-[1-(3-methoxyphenyl)cyclopentyl]methanone (PubChem CID 126813294) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 2,7-diazaspiro[4.5]decan-7-yl-[1-(3-methoxyphenyl)cyclopentyl]methanone.
| Compound Name | 2,7-diazaspiro[4.5]decan-7-yl-[1-(3-methoxyphenyl)cyclopentyl]methanone |
|---|---|
| PubChem CID | 126813294 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 2,7-diazaspiro[4.5]decan-7-yl-[1-(3-methoxyphenyl)cyclopentyl]methanone |
| SMILES | COc1cccc(C2(C(=O)N3CCCC4(CCNC4)C3)CCCC2)c1 |
| InChI | InChI=1S/C21H30N2O2/c1-25-18-7-4-6-17(14-18)21(9-2-3-10-21)19(24)23-13-5-8-20(16-23)11-12-22-15-20/h4,6-7,14,22H,2-3,5,8-13,15-16H2,1H3 |
| InChIKey | HEIQVFQTYJFTKX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |