C19H27NO3 — CID 126815250
3-cyclopropyl-N-[4-(hydroxymethyl)cyclohexyl]-3-(4-hydroxyphenyl)propanamide (PubChem CID 126815250) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-cyclopropyl-N-[4-(hydroxymethyl)cyclohexyl]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | 3-cyclopropyl-N-[4-(hydroxymethyl)cyclohexyl]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 126815250 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 3-cyclopropyl-N-[4-(hydroxymethyl)cyclohexyl]-3-(4-hydroxyphenyl)propanamide |
| SMILES | O=C(CC(c1ccc(O)cc1)C1CC1)NC1CCC(CO)CC1 |
| InChI | InChI=1S/C19H27NO3/c21-12-13-1-7-16(8-2-13)20-19(23)11-18(14-3-4-14)15-5-9-17(22)10-6-15/h5-6,9-10,13-14,16,18,21-22H,1-4,7-8,11-12H2,(H,20,23) |
| InChIKey | NLHPDWJGUZPLFG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |