C19H30N2O3 — CID 126826422
N-[4-(hydroxymethyl)cyclohexyl]-2-(4-methoxyphenyl)-2-(propan-2-ylamino)acetamide (PubChem CID 126826422) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)cyclohexyl]-2-(4-methoxyphenyl)-2-(propan-2-ylamino)acetamide.
| Compound Name | N-[4-(hydroxymethyl)cyclohexyl]-2-(4-methoxyphenyl)-2-(propan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 126826422 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | N-[4-(hydroxymethyl)cyclohexyl]-2-(4-methoxyphenyl)-2-(propan-2-ylamino)acetamide |
| SMILES | COc1ccc(C(NC(C)C)C(=O)NC2CCC(CO)CC2)cc1 |
| InChI | InChI=1S/C19H30N2O3/c1-13(2)20-18(15-6-10-17(24-3)11-7-15)19(23)21-16-8-4-14(12-22)5-9-16/h6-7,10-11,13-14,16,18,20,22H,4-5,8-9,12H2,1-3H3,(H,21,23) |
| InChIKey | UKHWZCSLAFMVIK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |