C16H30N2O3 — CID 126816532
1-(1,4-dioxan-2-ylmethyl)-N-pentan-2-ylpiperidine-3-carboxamide (PubChem CID 126816532) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-ylmethyl)-N-pentan-2-ylpiperidine-3-carboxamide.
| Compound Name | 1-(1,4-dioxan-2-ylmethyl)-N-pentan-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 126816532 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 1-(1,4-dioxan-2-ylmethyl)-N-pentan-2-ylpiperidine-3-carboxamide |
| SMILES | CCCC(C)NC(=O)C1CCCN(CC2COCCO2)C1 |
| InChI | InChI=1S/C16H30N2O3/c1-3-5-13(2)17-16(19)14-6-4-7-18(10-14)11-15-12-20-8-9-21-15/h13-15H,3-12H2,1-2H3,(H,17,19) |
| InChIKey | NFVAZVCQMPNXPU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |