C17H34N2O3 — CID 97307433
(3R)-1-(2,2-diethoxyethyl)-N-[(2S)-pentan-2-yl]piperidine-3-carboxamide (PubChem CID 97307433) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is (3R)-1-(2,2-diethoxyethyl)-N-[(2S)-pentan-2-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(2,2-diethoxyethyl)-N-[(2S)-pentan-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97307433 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (3R)-1-(2,2-diethoxyethyl)-N-[(2S)-pentan-2-yl]piperidine-3-carboxamide |
| SMILES | CCC[C@H](C)NC(=O)[C@@H]1CCCN(CC(OCC)OCC)C1 |
| InChI | InChI=1S/C17H34N2O3/c1-5-9-14(4)18-17(20)15-10-8-11-19(12-15)13-16(21-6-2)22-7-3/h14-16H,5-13H2,1-4H3,(H,18,20)/t14-,15+/m0/s1 |
| InChIKey | KOXMGODERWQAFH-LSDHHAIUSA-N |
| XLogP | 2.40 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|