C13H18BrNO3S — CID 126818902
2-bromo-3-[(6-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]phenol (PubChem CID 126818902) has the molecular formula C13H18BrNO3S and a molecular weight of 348.26 g/mol. Its IUPAC name is 2-bromo-3-[(6-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]phenol.
| Compound Name | 2-bromo-3-[(6-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]phenol |
|---|---|
| PubChem CID | 126818902 |
| Molecular Formula | C13H18BrNO3S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 2-bromo-3-[(6-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]phenol |
| SMILES | CC1CN(Cc2cccc(O)c2Br)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18BrNO3S/c1-10-7-15(5-6-19(17,18)9-10)8-11-3-2-4-12(16)13(11)14/h2-4,10,16H,5-9H2,1H3 |
| InChIKey | YLAWFWREAJFPEE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |