C15H26N2O3S2 — CID 126819342
N-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-2-(cyclopropylmethoxy)ethanesulfonamide (PubChem CID 126819342) has the molecular formula C15H26N2O3S2 and a molecular weight of 346.52 g/mol. Its IUPAC name is N-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-2-(cyclopropylmethoxy)ethanesulfonamide.
| Compound Name | N-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-2-(cyclopropylmethoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 126819342 |
| Molecular Formula | C15H26N2O3S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-2-(cyclopropylmethoxy)ethanesulfonamide |
| SMILES | CC(C)(C)c1csc(CCNS(=O)(=O)CCOCC2CC2)n1 |
| InChI | InChI=1S/C15H26N2O3S2/c1-15(2,3)13-11-21-14(17-13)6-7-16-22(18,19)9-8-20-10-12-4-5-12/h11-12,16H,4-10H2,1-3H3 |
| InChIKey | KYVXJKTUMHJQBA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|