C11H13F3N4O3S — CID 126820702
1-(6-cyclopropylpyridazin-3-yl)-3-[2-(trifluoromethylsulfonyl)ethyl]urea (PubChem CID 126820702) has the molecular formula C11H13F3N4O3S and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-(6-cyclopropylpyridazin-3-yl)-3-[2-(trifluoromethylsulfonyl)ethyl]urea.
| Compound Name | 1-(6-cyclopropylpyridazin-3-yl)-3-[2-(trifluoromethylsulfonyl)ethyl]urea |
|---|---|
| PubChem CID | 126820702 |
| Molecular Formula | C11H13F3N4O3S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-(6-cyclopropylpyridazin-3-yl)-3-[2-(trifluoromethylsulfonyl)ethyl]urea |
| SMILES | O=C(NCCS(=O)(=O)C(F)(F)F)Nc1ccc(C2CC2)nn1 |
| InChI | InChI=1S/C11H13F3N4O3S/c12-11(13,14)22(20,21)6-5-15-10(19)16-9-4-3-8(17-18-9)7-1-2-7/h3-4,7H,1-2,5-6H2,(H2,15,16,18,19) |
| InChIKey | MSUZVPIZIXLOQU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |