C12H15BrN6O — CID 126820728
1-[(5-bromopyrazin-2-yl)methyl]-3-(3-ethyl-1-methylpyrazol-5-yl)urea (PubChem CID 126820728) has the molecular formula C12H15BrN6O and a molecular weight of 339.20 g/mol. Its IUPAC name is 1-[(5-bromopyrazin-2-yl)methyl]-3-(3-ethyl-1-methylpyrazol-5-yl)urea.
| Compound Name | 1-[(5-bromopyrazin-2-yl)methyl]-3-(3-ethyl-1-methylpyrazol-5-yl)urea |
|---|---|
| PubChem CID | 126820728 |
| Molecular Formula | C12H15BrN6O |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1-[(5-bromopyrazin-2-yl)methyl]-3-(3-ethyl-1-methylpyrazol-5-yl)urea |
| SMILES | CCc1cc(NC(=O)NCc2cnc(Br)cn2)n(C)n1 |
| InChI | InChI=1S/C12H15BrN6O/c1-3-8-4-11(19(2)18-8)17-12(20)16-6-9-5-15-10(13)7-14-9/h4-5,7H,3,6H2,1-2H3,(H2,16,17,20) |
| InChIKey | USPZVNBSSMESPL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |