C15H27NO2 — CID 126820800
1-[2-(1-hydroxypropyl)piperidin-1-yl]-2,4-dimethylpent-4-en-1-one (PubChem CID 126820800) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-[2-(1-hydroxypropyl)piperidin-1-yl]-2,4-dimethylpent-4-en-1-one.
| Compound Name | 1-[2-(1-hydroxypropyl)piperidin-1-yl]-2,4-dimethylpent-4-en-1-one |
|---|---|
| PubChem CID | 126820800 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 1-[2-(1-hydroxypropyl)piperidin-1-yl]-2,4-dimethylpent-4-en-1-one |
| SMILES | C=C(C)CC(C)C(=O)N1CCCCC1C(O)CC |
| InChI | InChI=1S/C15H27NO2/c1-5-14(17)13-8-6-7-9-16(13)15(18)12(4)10-11(2)3/h12-14,17H,2,5-10H2,1,3-4H3 |
| InChIKey | ZTUGJBCLURHORW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|