C9H16O3 — CID 1268214
cis-ethyl (1R,2S)-2-hydroxycyclohexane-1-carboxylate (PubChem CID 1268214) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-hydroxycyclohexane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 1268214 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | cis-ethyl (1R,2S)-2-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C9H16O3/c1-2-12-9(11)7-5-3-4-6-8(7)10/h7-8,10H,2-6H2,1H3/t7-,8+/m1/s1 |
| InChIKey | WOGRTPJVNNCUKN-SFYZADRCSA-N |
| XLogP | 1.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |