C12H18F3NO2 — CID 126821498
N-[[2-(2,2,2-trifluoroethoxy)cyclohexyl]methyl]prop-2-enamide (PubChem CID 126821498) has the molecular formula C12H18F3NO2 and a molecular weight of 265.27 g/mol. Its IUPAC name is N-[[2-(2,2,2-trifluoroethoxy)cyclohexyl]methyl]prop-2-enamide.
| Compound Name | N-[[2-(2,2,2-trifluoroethoxy)cyclohexyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 126821498 |
| Molecular Formula | C12H18F3NO2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-[[2-(2,2,2-trifluoroethoxy)cyclohexyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC1CCCCC1OCC(F)(F)F |
| InChI | InChI=1S/C12H18F3NO2/c1-2-11(17)16-7-9-5-3-4-6-10(9)18-8-12(13,14)15/h2,9-10H,1,3-8H2,(H,16,17) |
| InChIKey | PHDVCMRSFBTCJL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|