C10H17NO2 — CID 166414342
N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]prop-2-enamide (PubChem CID 166414342) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]prop-2-enamide.
| Compound Name | N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166414342 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NC[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C10H17NO2/c1-2-10(13)11-7-8-5-3-4-6-9(8)12/h2,8-9,12H,1,3-7H2,(H,11,13)/t8-,9+/m1/s1 |
| InChIKey | PGBPRXWFZLSJGD-BDAKNGLRSA-N |
| XLogP | 0.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|