C14H20N2O5S2 — CID 126822086
[2-(morpholin-4-ylsulfonylmethyl)morpholin-4-yl]-thiophen-2-ylmethanone (PubChem CID 126822086) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is [2-(morpholin-4-ylsulfonylmethyl)morpholin-4-yl]-thiophen-2-ylmethanone.
| Compound Name | [2-(morpholin-4-ylsulfonylmethyl)morpholin-4-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 126822086 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [2-(morpholin-4-ylsulfonylmethyl)morpholin-4-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCOC(CS(=O)(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C14H20N2O5S2/c17-14(13-2-1-9-22-13)15-3-8-21-12(10-15)11-23(18,19)16-4-6-20-7-5-16/h1-2,9,12H,3-8,10-11H2 |
| InChIKey | QIGTWXAVJCLNJN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |