C13H18N2O4S2 — CID 125423656
[3-(morpholin-4-ylsulfonylmethyl)azetidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 125423656) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is [3-(morpholin-4-ylsulfonylmethyl)azetidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [3-(morpholin-4-ylsulfonylmethyl)azetidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 125423656 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | [3-(morpholin-4-ylsulfonylmethyl)azetidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CC(CS(=O)(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C13H18N2O4S2/c16-13(12-2-1-7-20-12)14-8-11(9-14)10-21(17,18)15-3-5-19-6-4-15/h1-2,7,11H,3-6,8-10H2 |
| InChIKey | LNWSJMRIUDLBOW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |