C12H18N2O4S2 — CID 125423662
N-[(2R)-2-hydroxypropyl]-1-[1-(thiophene-2-carbonyl)azetidin-3-yl]methanesulfonamide (PubChem CID 125423662) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]-1-[1-(thiophene-2-carbonyl)azetidin-3-yl]methanesulfonamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]-1-[1-(thiophene-2-carbonyl)azetidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 125423662 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]-1-[1-(thiophene-2-carbonyl)azetidin-3-yl]methanesulfonamide |
| SMILES | C[C@@H](O)CNS(=O)(=O)CC1CN(C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C12H18N2O4S2/c1-9(15)5-13-20(17,18)8-10-6-14(7-10)12(16)11-3-2-4-19-11/h2-4,9-10,13,15H,5-8H2,1H3/t9-/m1/s1 |
| InChIKey | OEYNWXUZZAYVHP-SECBINFHSA-N |
| XLogP | 0.12 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |