C15H17N3O4S — CID 131687546
[(3aR,6aS)-3-(morpholine-4-carbonyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazol-5-yl]-thiophen-2-ylmethanone (PubChem CID 131687546) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is [(3aR,6aS)-3-(morpholine-4-carbonyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazol-5-yl]-thiophen-2-ylmethanone.
| Compound Name | [(3aR,6aS)-3-(morpholine-4-carbonyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazol-5-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 131687546 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | [(3aR,6aS)-3-(morpholine-4-carbonyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazol-5-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(C1=NO[C@@H]2CN(C(=O)c3cccs3)C[C@H]12)N1CCOCC1 |
| InChI | InChI=1S/C15H17N3O4S/c19-14(12-2-1-7-23-12)18-8-10-11(9-18)22-16-13(10)15(20)17-3-5-21-6-4-17/h1-2,7,10-11H,3-6,8-9H2/t10-,11+/m0/s1 |
| InChIKey | FSUZXLNPFDVYHZ-WDEREUQCSA-N |
| XLogP | 0.43 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |