C23H22N2O4 — CID 126822393
2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxo-3-[(1R,3R)-3-phenylcyclopentyl]propanamide (PubChem CID 126822393) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxo-3-[(1R,3R)-3-phenylcyclopentyl]propanamide.
| Compound Name | 2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxo-3-[(1R,3R)-3-phenylcyclopentyl]propanamide |
|---|---|
| PubChem CID | 126822393 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxo-3-[(1R,3R)-3-phenylcyclopentyl]propanamide |
| SMILES | N#CC(C(=O)Nc1ccc2c(c1)OCCO2)C(=O)[C@@H]1CC[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H22N2O4/c24-14-19(22(26)17-7-6-16(12-17)15-4-2-1-3-5-15)23(27)25-18-8-9-20-21(13-18)29-11-10-28-20/h1-5,8-9,13,16-17,19H,6-7,10-12H2,(H,25,27)/t16-,17-,19?/m1/s1 |
| InChIKey | KYLMIIJTJLVDNS-QNZPCDNOSA-N |
| XLogP | 3.69 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|