C21H17N3O4 — CID 98284952
(2R)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(1-methylindol-3-yl)-3-oxopropanamide (PubChem CID 98284952) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is (2R)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(1-methylindol-3-yl)-3-oxopropanamide.
| Compound Name | (2R)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(1-methylindol-3-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 98284952 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (2R)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(1-methylindol-3-yl)-3-oxopropanamide |
| SMILES | Cn1cc(C(=O)[C@@H](C#N)C(=O)Nc2ccc3c(c2)OCCO3)c2ccccc21 |
| InChI | InChI=1S/C21H17N3O4/c1-24-12-16(14-4-2-3-5-17(14)24)20(25)15(11-22)21(26)23-13-6-7-18-19(10-13)28-9-8-27-18/h2-7,10,12,15H,8-9H2,1H3,(H,23,26)/t15-/m1/s1 |
| InChIKey | VSSOIFHLHJXFBN-OAHLLOKOSA-N |
| XLogP | 2.91 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|