C15H17N3O4S2 — CID 126822629
N-(2-morpholin-4-ylsulfonylphenyl)-2-(1,3-thiazol-4-yl)acetamide (PubChem CID 126822629) has the molecular formula C15H17N3O4S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(2-morpholin-4-ylsulfonylphenyl)-2-(1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(2-morpholin-4-ylsulfonylphenyl)-2-(1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 126822629 |
| Molecular Formula | C15H17N3O4S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-(2-morpholin-4-ylsulfonylphenyl)-2-(1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1cscn1)Nc1ccccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H17N3O4S2/c19-15(9-12-10-23-11-16-12)17-13-3-1-2-4-14(13)24(20,21)18-5-7-22-8-6-18/h1-4,10-11H,5-9H2,(H,17,19) |
| InChIKey | JBQZNHQPGIVVEE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |