C14H13ClN2O5S — CID 126823216
3-(5-chloro-2-methoxyphenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)prop-2-enamide (PubChem CID 126823216) has the molecular formula C14H13ClN2O5S and a molecular weight of 356.79 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)prop-2-enamide.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)prop-2-enamide |
|---|---|
| PubChem CID | 126823216 |
| Molecular Formula | C14H13ClN2O5S |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1C=CC(=O)NS(=O)(=O)Cc1ccon1 |
| InChI | InChI=1S/C14H13ClN2O5S/c1-21-13-4-3-11(15)8-10(13)2-5-14(18)17-23(19,20)9-12-6-7-22-16-12/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | IXVGCHYRCUHOAV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|