C13H22N4O5 — CID 126824065
N-(2,2-diethoxyethyl)-N-ethyl-2-(4-nitropyrazol-1-yl)acetamide (PubChem CID 126824065) has the molecular formula C13H22N4O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-N-ethyl-2-(4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-(2,2-diethoxyethyl)-N-ethyl-2-(4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 126824065 |
| Molecular Formula | C13H22N4O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-(2,2-diethoxyethyl)-N-ethyl-2-(4-nitropyrazol-1-yl)acetamide |
| SMILES | CCOC(CN(CC)C(=O)Cn1cc([N+](=O)[O-])cn1)OCC |
| InChI | InChI=1S/C13H22N4O5/c1-4-15(10-13(21-5-2)22-6-3)12(18)9-16-8-11(7-14-16)17(19)20/h7-8,13H,4-6,9-10H2,1-3H3 |
| InChIKey | FNFAVELZJJDANY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|