C9H16N2O2 — CID 126824791
4-hydroxy-2,9-diazaspiro[5.5]undecan-1-one (PubChem CID 126824791) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 4-hydroxy-2,9-diazaspiro[5.5]undecan-1-one.
| Compound Name | 4-hydroxy-2,9-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 126824791 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 4-hydroxy-2,9-diazaspiro[5.5]undecan-1-one |
| SMILES | O=C1NCC(O)CC12CCNCC2 |
| InChI | InChI=1S/C9H16N2O2/c12-7-5-9(8(13)11-6-7)1-3-10-4-2-9/h7,10,12H,1-6H2,(H,11,13) |
| InChIKey | PGLKLRYVJYKCEP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |