C9H15NO3 — CID 126836629
4-hydroxy-9-oxa-2-azaspiro[5.5]undecan-1-one (PubChem CID 126836629) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 4-hydroxy-9-oxa-2-azaspiro[5.5]undecan-1-one.
| Compound Name | 4-hydroxy-9-oxa-2-azaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 126836629 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 4-hydroxy-9-oxa-2-azaspiro[5.5]undecan-1-one |
| SMILES | O=C1NCC(O)CC12CCOCC2 |
| InChI | InChI=1S/C9H15NO3/c11-7-5-9(8(12)10-6-7)1-3-13-4-2-9/h7,11H,1-6H2,(H,10,12) |
| InChIKey | IKVLVYQJCUKZOL-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |