About 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide
6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide (PubChem CID 126826695) has the molecular formula C16H23N5O3S
and a molecular weight of 365.46 g/mol. Its IUPAC name is 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide |
| PubChem CID | 126826695 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide |
| SMILES | CCn1ccnc1[C@@H]1OCC[C@H]1NS(=O)(=O)c1ccc(N(C)C)nc1 |
| InChI | InChI=1S/C16H23N5O3S/c1-4-21-9-8-17-16(21)15-13(7-10-24-15)19-25(22,23)12-5-6-14(18-11-12)20(2)3/h5-6,8-9,11,13,15,19H,4,7,10H2,1-3H3/t13-,15-/m1/s1 |
| InChIKey | FOJMUDLPLXTRTJ-UKRRQHHQSA-N |
| XLogP | 1.17 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide?
The IUPAC name of 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide (CID 126826695) is 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide.
What is the SMILES notation for 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide?
The canonical SMILES for 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide is CCn1ccnc1[C@@H]1OCC[C@H]1NS(=O)(=O)c1ccc(N(C)C)nc1.
What is the InChIKey of 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide?
The InChIKey is FOJMUDLPLXTRTJ-UKRRQHHQSA-N. The full InChI is InChI=1S/C16H23N5O3S/c1-4-21-9-8-17-16(21)15-13(7-10-24-15)19-25(22,23)12-5-6-14(18-11-12)20(2)3/h5-6,8-9,11,13,15,19H,4,7,10H2,1-3H3/t13-,15-/m1/s1.
What are the key properties of 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide?
6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide has a molecular weight of 365.46 g/mol, XLogP of 1.17, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-N-[(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]pyridine-3-sulfonamide is sourced from PubChem (CID 126826695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).