About 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide
5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide (PubChem CID 127967879) has the molecular formula C17H24N6O2
and a molecular weight of 344.42 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide |
| PubChem CID | 127967879 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide |
| SMILES | CCn1ccnc1[C@H]1OCCC[C@@H]1NC(=O)c1cnc(N(C)C)cn1 |
| InChI | InChI=1S/C17H24N6O2/c1-4-23-8-7-18-16(23)15-12(6-5-9-25-15)21-17(24)13-10-20-14(11-19-13)22(2)3/h7-8,10-12,15H,4-6,9H2,1-3H3,(H,21,24)/t12-,15-/m0/s1 |
| InChIKey | ANFOQMHYXSMEHI-WFASDCNBSA-N |
| XLogP | 1.41 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide?
The IUPAC name of 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide (CID 127967879) is 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide.
What is the SMILES notation for 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide?
The canonical SMILES for 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide is CCn1ccnc1[C@H]1OCCC[C@@H]1NC(=O)c1cnc(N(C)C)cn1.
What is the InChIKey of 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide?
The InChIKey is ANFOQMHYXSMEHI-WFASDCNBSA-N. The full InChI is InChI=1S/C17H24N6O2/c1-4-23-8-7-18-16(23)15-12(6-5-9-25-15)21-17(24)13-10-20-14(11-19-13)22(2)3/h7-8,10-12,15H,4-6,9H2,1-3H3,(H,21,24)/t12-,15-/m0/s1.
What are the key properties of 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide?
5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide has a molecular weight of 344.42 g/mol, XLogP of 1.41, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrazine-2-carboxamide is sourced from PubChem (CID 127967879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).