C17H19N5O3 — CID 126826964
1-(1-methylpyrazol-4-yl)-4-[3-(2-nitrophenyl)prop-2-enyl]piperazin-2-one (PubChem CID 126826964) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)-4-[3-(2-nitrophenyl)prop-2-enyl]piperazin-2-one.
| Compound Name | 1-(1-methylpyrazol-4-yl)-4-[3-(2-nitrophenyl)prop-2-enyl]piperazin-2-one |
|---|---|
| PubChem CID | 126826964 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)-4-[3-(2-nitrophenyl)prop-2-enyl]piperazin-2-one |
| SMILES | Cn1cc(N2CCN(CC=Cc3ccccc3[N+](=O)[O-])CC2=O)cn1 |
| InChI | InChI=1S/C17H19N5O3/c1-19-12-15(11-18-19)21-10-9-20(13-17(21)23)8-4-6-14-5-2-3-7-16(14)22(24)25/h2-7,11-12H,8-10,13H2,1H3 |
| InChIKey | CVCDQOPIBKEQGM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|