C19H19F2N3O4 — CID 126827082
5-[[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl]-4,6,7,8-tetrahydrofuro[3,2-c]azepine (PubChem CID 126827082) has the molecular formula C19H19F2N3O4 and a molecular weight of 391.37 g/mol. Its IUPAC name is 5-[[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl]-4,6,7,8-tetrahydrofuro[3,2-c]azepine.
| Compound Name | 5-[[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl]-4,6,7,8-tetrahydrofuro[3,2-c]azepine |
|---|---|
| PubChem CID | 126827082 |
| Molecular Formula | C19H19F2N3O4 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 5-[[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl]-4,6,7,8-tetrahydrofuro[3,2-c]azepine |
| SMILES | COc1cc(-c2noc(CN3CCCc4occc4C3)n2)ccc1OC(F)F |
| InChI | InChI=1S/C19H19F2N3O4/c1-25-16-9-12(4-5-15(16)27-19(20)21)18-22-17(28-23-18)11-24-7-2-3-14-13(10-24)6-8-26-14/h4-6,8-9,19H,2-3,7,10-11H2,1H3 |
| InChIKey | BXULCBLRPXVQNI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 73.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |