C16H12F2N4O6 — CID 55445343
1-[[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl]-5-nitropyridin-2-one (PubChem CID 55445343) has the molecular formula C16H12F2N4O6 and a molecular weight of 394.29 g/mol. Its IUPAC name is 1-[[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl]-5-nitropyridin-2-one.
| Compound Name | 1-[[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl]-5-nitropyridin-2-one |
|---|---|
| PubChem CID | 55445343 |
| Molecular Formula | C16H12F2N4O6 |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-[[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl]-5-nitropyridin-2-one |
| SMILES | COc1cc(-c2noc(Cn3cc([N+](=O)[O-])ccc3=O)n2)ccc1OC(F)F |
| InChI | InChI=1S/C16H12F2N4O6/c1-26-12-6-9(2-4-11(12)27-16(17)18)15-19-13(28-20-15)8-21-7-10(22(24)25)3-5-14(21)23/h2-7,16H,8H2,1H3 |
| InChIKey | WKCBDCDHNLPURO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 122.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|