C19H15F2N3O8 — CID 55364805
[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl 2-(2-nitrophenoxy)acetate (PubChem CID 55364805) has the molecular formula C19H15F2N3O8 and a molecular weight of 451.34 g/mol. Its IUPAC name is [3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl 2-(2-nitrophenoxy)acetate.
| Compound Name | [3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 55364805 |
| Molecular Formula | C19H15F2N3O8 |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | [3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl 2-(2-nitrophenoxy)acetate |
| SMILES | COc1cc(-c2noc(COC(=O)COc3ccccc3[N+](=O)[O-])n2)ccc1OC(F)F |
| InChI | InChI=1S/C19H15F2N3O8/c1-28-15-8-11(6-7-14(15)31-19(20)21)18-22-16(32-23-18)9-30-17(25)10-29-13-5-3-2-4-12(13)24(26)27/h2-8,19H,9-10H2,1H3 |
| InChIKey | GSWWGADFMMNIIL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 136.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|