C16H18N4S — CID 126827285
3-[5-[[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]pyridine (PubChem CID 126827285) has the molecular formula C16H18N4S and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-[5-[[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 3-[5-[[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 126827285 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-[5-[[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]pyridine |
| SMILES | Cn1c(SCC2C[C@H]3C=C[C@@H]2C3)nnc1-c1cccnc1 |
| InChI | InChI=1S/C16H18N4S/c1-20-15(13-3-2-6-17-9-13)18-19-16(20)21-10-14-8-11-4-5-12(14)7-11/h2-6,9,11-12,14H,7-8,10H2,1H3/t11-,12+,14?/m0/s1 |
| InChIKey | JDSUBNOATFJXTC-KTYPHDMWSA-N |
| XLogP | 3.18 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|