C14H14ClN3O3 — CID 126829951
5-chloro-N-(oxolan-2-ylmethyl)-N-pyridazin-4-ylfuran-2-carboxamide (PubChem CID 126829951) has the molecular formula C14H14ClN3O3 and a molecular weight of 307.74 g/mol. Its IUPAC name is 5-chloro-N-(oxolan-2-ylmethyl)-N-pyridazin-4-ylfuran-2-carboxamide.
| Compound Name | 5-chloro-N-(oxolan-2-ylmethyl)-N-pyridazin-4-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 126829951 |
| Molecular Formula | C14H14ClN3O3 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 5-chloro-N-(oxolan-2-ylmethyl)-N-pyridazin-4-ylfuran-2-carboxamide |
| SMILES | O=C(c1ccc(Cl)o1)N(CC1CCCO1)c1ccnnc1 |
| InChI | InChI=1S/C14H14ClN3O3/c15-13-4-3-12(21-13)14(19)18(9-11-2-1-7-20-11)10-5-6-16-17-8-10/h3-6,8,11H,1-2,7,9H2 |
| InChIKey | LOQAPOOHJHWVPE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |