C17H17Cl2N3O2 — CID 167810660
2-(2,5-dichlorophenyl)-N-(oxolan-2-ylmethyl)-N-pyridazin-4-ylacetamide (PubChem CID 167810660) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-N-(oxolan-2-ylmethyl)-N-pyridazin-4-ylacetamide.
| Compound Name | 2-(2,5-dichlorophenyl)-N-(oxolan-2-ylmethyl)-N-pyridazin-4-ylacetamide |
|---|---|
| PubChem CID | 167810660 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-N-(oxolan-2-ylmethyl)-N-pyridazin-4-ylacetamide |
| SMILES | O=C(Cc1cc(Cl)ccc1Cl)N(CC1CCCO1)c1ccnnc1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c18-13-3-4-16(19)12(8-13)9-17(23)22(11-15-2-1-7-24-15)14-5-6-20-21-10-14/h3-6,8,10,15H,1-2,7,9,11H2 |
| InChIKey | QLQCFHRDYBMEJI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |