C22H26Cl2N2O4S — CID 55754212
N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(oxolan-2-ylmethoxy)-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 55754212) has the molecular formula C22H26Cl2N2O4S and a molecular weight of 485.43 g/mol. Its IUPAC name is N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(oxolan-2-ylmethoxy)-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(oxolan-2-ylmethoxy)-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 55754212 |
| Molecular Formula | C22H26Cl2N2O4S |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(oxolan-2-ylmethoxy)-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | O=C(CCOCC1CCCO1)N(CC1CCCO1)c1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C22H26Cl2N2O4S/c23-15-5-6-18(19(24)11-15)20-14-31-22(25-20)26(12-16-3-1-8-29-16)21(27)7-10-28-13-17-4-2-9-30-17/h5-6,11,14,16-17H,1-4,7-10,12-13H2 |
| InChIKey | GHCSGUVWLBNDFY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|