C12H19N3O4S2 — CID 126829988
(2R)-N-[5-(tert-butylsulfamoyl)-1,3-thiazol-2-yl]oxolane-2-carboxamide (PubChem CID 126829988) has the molecular formula C12H19N3O4S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is (2R)-N-[5-(tert-butylsulfamoyl)-1,3-thiazol-2-yl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[5-(tert-butylsulfamoyl)-1,3-thiazol-2-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 126829988 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (2R)-N-[5-(tert-butylsulfamoyl)-1,3-thiazol-2-yl]oxolane-2-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cnc(NC(=O)[C@H]2CCCO2)s1 |
| InChI | InChI=1S/C12H19N3O4S2/c1-12(2,3)15-21(17,18)9-7-13-11(20-9)14-10(16)8-5-4-6-19-8/h7-8,15H,4-6H2,1-3H3,(H,13,14,16)/t8-/m1/s1 |
| InChIKey | IBXMFKCQZDXSRN-MRVPVSSYSA-N |
| XLogP | 1.34 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |