C17H26FN3O — CID 126830524
3-[4-(dimethylamino)-4-methylpiperidin-1-yl]-N-(3-fluorophenyl)propanamide (PubChem CID 126830524) has the molecular formula C17H26FN3O and a molecular weight of 307.41 g/mol. Its IUPAC name is 3-[4-(dimethylamino)-4-methylpiperidin-1-yl]-N-(3-fluorophenyl)propanamide.
| Compound Name | 3-[4-(dimethylamino)-4-methylpiperidin-1-yl]-N-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 126830524 |
| Molecular Formula | C17H26FN3O |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 3-[4-(dimethylamino)-4-methylpiperidin-1-yl]-N-(3-fluorophenyl)propanamide |
| SMILES | CN(C)C1(C)CCN(CCC(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H26FN3O/c1-17(20(2)3)8-11-21(12-9-17)10-7-16(22)19-15-6-4-5-14(18)13-15/h4-6,13H,7-12H2,1-3H3,(H,19,22) |
| InChIKey | WCQVDZKPKRJNEP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |