C21H23F2N3O5 — CID 171154645
N-(3-fluorophenyl)-3-[4-(2-fluorophenyl)piperazin-1-yl]propanamide;oxalic acid (PubChem CID 171154645) has the molecular formula C21H23F2N3O5 and a molecular weight of 435.43 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3-[4-(2-fluorophenyl)piperazin-1-yl]propanamide;oxalic acid.
| Compound Name | N-(3-fluorophenyl)-3-[4-(2-fluorophenyl)piperazin-1-yl]propanamide;oxalic acid |
|---|---|
| PubChem CID | 171154645 |
| Molecular Formula | C21H23F2N3O5 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-(3-fluorophenyl)-3-[4-(2-fluorophenyl)piperazin-1-yl]propanamide;oxalic acid |
| SMILES | O=C(CCN1CCN(c2ccccc2F)CC1)Nc1cccc(F)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H21F2N3O.C2H2O4/c20-15-4-3-5-16(14-15)22-19(25)8-9-23-10-12-24(13-11-23)18-7-2-1-6-17(18)21;3-1(4)2(5)6/h1-7,14H,8-13H2,(H,22,25);(H,3,4)(H,5,6) |
| InChIKey | CUQJRAPPNDCKSY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|