C8H10F3NO4S3 — CID 126831504
3-methoxy-N-[2-(trifluoromethylsulfinyl)ethyl]thiophene-2-sulfonamide (PubChem CID 126831504) has the molecular formula C8H10F3NO4S3 and a molecular weight of 337.37 g/mol. Its IUPAC name is 3-methoxy-N-[2-(trifluoromethylsulfinyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 3-methoxy-N-[2-(trifluoromethylsulfinyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 126831504 |
| Molecular Formula | C8H10F3NO4S3 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 3-methoxy-N-[2-(trifluoromethylsulfinyl)ethyl]thiophene-2-sulfonamide |
| SMILES | COc1ccsc1S(=O)(=O)NCCS(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO4S3/c1-16-6-2-4-17-7(6)19(14,15)12-3-5-18(13)8(9,10)11/h2,4,12H,3,5H2,1H3 |
| InChIKey | YMPRWJZTJJLAOD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |