C13H18N6O2 — CID 126831645
1-(4-hydroxybutyl)-3-[4-(5-methyl-1H-1,2,4-triazol-3-yl)-2-pyridinyl]urea (PubChem CID 126831645) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-(4-hydroxybutyl)-3-[4-(5-methyl-1H-1,2,4-triazol-3-yl)-2-pyridinyl]urea.
| Compound Name | 1-(4-hydroxybutyl)-3-[4-(5-methyl-1H-1,2,4-triazol-3-yl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 126831645 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-(4-hydroxybutyl)-3-[4-(5-methyl-1H-1,2,4-triazol-3-yl)-2-pyridinyl]urea |
| SMILES | Cc1nc(-c2ccnc(NC(=O)NCCCCO)c2)n[nH]1 |
| InChI | InChI=1S/C13H18N6O2/c1-9-16-12(19-18-9)10-4-6-14-11(8-10)17-13(21)15-5-2-3-7-20/h4,6,8,20H,2-3,5,7H2,1H3,(H,16,18,19)(H2,14,15,17,21) |
| InChIKey | QRFMDQWIWVKCSG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|