C11H15N3O3 — CID 126831922
1-[3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]azetidin-1-yl]prop-2-en-1-one (PubChem CID 126831922) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-[3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 126831922 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 1-[3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(OCc2nc(CC)no2)C1 |
| InChI | InChI=1S/C11H15N3O3/c1-3-9-12-10(17-13-9)7-16-8-5-14(6-8)11(15)4-2/h4,8H,2-3,5-7H2,1H3 |
| InChIKey | QZBURQDKBNBQJY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|