C14H16BrNO2S — CID 126832340
2-[2-[5-(bromomethyl)-2-methoxyphenyl]-5-methyl-1,3-thiazol-4-yl]ethanol (PubChem CID 126832340) has the molecular formula C14H16BrNO2S and a molecular weight of 342.26 g/mol. Its IUPAC name is 2-[2-[5-(bromomethyl)-2-methoxyphenyl]-5-methyl-1,3-thiazol-4-yl]ethanol.
| Compound Name | 2-[2-[5-(bromomethyl)-2-methoxyphenyl]-5-methyl-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 126832340 |
| Molecular Formula | C14H16BrNO2S |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 2-[2-[5-(bromomethyl)-2-methoxyphenyl]-5-methyl-1,3-thiazol-4-yl]ethanol |
| SMILES | COc1ccc(CBr)cc1-c1nc(CCO)c(C)s1 |
| InChI | InChI=1S/C14H16BrNO2S/c1-9-12(5-6-17)16-14(19-9)11-7-10(8-15)3-4-13(11)18-2/h3-4,7,17H,5-6,8H2,1-2H3 |
| InChIKey | KFISUDMJBYUJKC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|