C21H22N6O2 — CID 126832825
2-[2-[methyl-[2-[methyl(pyrido[2,3-b]pyrazin-6-yl)amino]ethyl]amino]ethyl]isoindole-1,3-dione (PubChem CID 126832825) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-[2-[methyl-[2-[methyl(pyrido[2,3-b]pyrazin-6-yl)amino]ethyl]amino]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[methyl-[2-[methyl(pyrido[2,3-b]pyrazin-6-yl)amino]ethyl]amino]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 126832825 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-[2-[methyl-[2-[methyl(pyrido[2,3-b]pyrazin-6-yl)amino]ethyl]amino]ethyl]isoindole-1,3-dione |
| SMILES | CN(CCN1C(=O)c2ccccc2C1=O)CCN(C)c1ccc2nccnc2n1 |
| InChI | InChI=1S/C21H22N6O2/c1-25(12-14-27-20(28)15-5-3-4-6-16(15)21(27)29)11-13-26(2)18-8-7-17-19(24-18)23-10-9-22-17/h3-10H,11-14H2,1-2H3 |
| InChIKey | MFWXKDMZLIETNX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 82.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|