About [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate
[2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate (PubChem CID 12683287) has the molecular formula C5H4F6N2O10S2
and a molecular weight of 430.21 g/mol. Its IUPAC name is [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate |
| PubChem CID | 12683287 |
| Molecular Formula | C5H4F6N2O10S2 |
| Molecular Weight | 430.21 g/mol |
| Exact Mass | 429.92 |
| IUPAC Name | [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate |
| SMILES | O=[N+]([O-])C(COS(=O)(=O)C(F)(F)F)(COS(=O)(=O)C(F)(F)F)[N+](=O)[O-] |
| InChI | InChI=1S/C5H4F6N2O10S2/c6-4(7,8)24(18,19)22-1-3(12(14)15,13(16)17)2-23-25(20,21)5(9,10)11/h1-2H2 |
| InChIKey | SNLUOXGYXOVEJD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 173.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate?
The IUPAC name of [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate (CID 12683287) is [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate.
What is the SMILES notation for [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate?
The canonical SMILES for [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate is O=[N+]([O-])C(COS(=O)(=O)C(F)(F)F)(COS(=O)(=O)C(F)(F)F)[N+](=O)[O-].
What is the InChIKey of [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate?
The InChIKey is SNLUOXGYXOVEJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F6N2O10S2/c6-4(7,8)24(18,19)22-1-3(12(14)15,13(16)17)2-23-25(20,21)5(9,10)11/h1-2H2.
What are the key properties of [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate?
[2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate has a molecular weight of 430.21 g/mol, XLogP of -0.03, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dinitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate is sourced from PubChem (CID 12683287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).