About (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate
(3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate (PubChem CID 12683288) has the molecular formula C4H5F3N2O8S
and a molecular weight of 298.15 g/mol. Its IUPAC name is (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate |
| PubChem CID | 12683288 |
| Molecular Formula | C4H5F3N2O8S |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate |
| SMILES | O=[N+]([O-])C(CO)(COS(=O)(=O)C(F)(F)F)[N+](=O)[O-] |
| InChI | InChI=1S/C4H5F3N2O8S/c5-4(6,7)18(15,16)17-2-3(1-10,8(11)12)9(13)14/h10H,1-2H2 |
| InChIKey | YELKYVKIAFYBSZ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate?
The IUPAC name of (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate (CID 12683288) is (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate.
What is the SMILES notation for (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate?
The canonical SMILES for (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate is O=[N+]([O-])C(CO)(COS(=O)(=O)C(F)(F)F)[N+](=O)[O-].
What is the InChIKey of (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate?
The InChIKey is YELKYVKIAFYBSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F3N2O8S/c5-4(6,7)18(15,16)17-2-3(1-10,8(11)12)9(13)14/h10H,1-2H2.
What are the key properties of (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate?
(3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate has a molecular weight of 298.15 g/mol, XLogP of -0.91, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2,2-dinitropropyl) trifluoromethanesulfonate is sourced from PubChem (CID 12683288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).