C10H17N3O5S2 — CID 126833412
5-(2-methoxybutylsulfonylamino)pyridine-2-sulfonamide (PubChem CID 126833412) has the molecular formula C10H17N3O5S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-(2-methoxybutylsulfonylamino)pyridine-2-sulfonamide.
| Compound Name | 5-(2-methoxybutylsulfonylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 126833412 |
| Molecular Formula | C10H17N3O5S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 5-(2-methoxybutylsulfonylamino)pyridine-2-sulfonamide |
| SMILES | CCC(CS(=O)(=O)Nc1ccc(S(N)(=O)=O)nc1)OC |
| InChI | InChI=1S/C10H17N3O5S2/c1-3-9(18-2)7-19(14,15)13-8-4-5-10(12-6-8)20(11,16)17/h4-6,9,13H,3,7H2,1-2H3,(H2,11,16,17) |
| InChIKey | GTSBTIQVHBOJLR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |